CH2=CH-(CH2)2-CH(CH3)-CH3

The compound you have described is called 4-methyl-2-pentene.

To further prepare for your university exams, you can review the properties and reactions of alkenes (such as 4-methyl-2-pentene) as well as the nomenclature rules for naming organic compounds. It would also be beneficial to learn about the different isomers and stereoisomers that can exist for such compounds. Additionally, make sure to understand the concept of functional groups and how they impact the chemical reactivity of organic molecules.